Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Poly(acrylic acid), 63 wt% solution in water; approx. M.W. 2,000
CAS: 9003-01-4 Molecular Formula: (C3H4O2)n Molecular Weight (g/mol): 72.06 MDL Number: MFCD00084394 InChI Key: NNMHYFLPFNGQFZ-UHFFFAOYSA-M Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 SMILES: OC(=O)C(-*)C-*
| PubChem CID | 6581 |
|---|---|
| CAS | 9003-01-4 |
| Molecular Weight (g/mol) | 72.06 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00084394 |
| SMILES | OC(=O)C(-*)C-* |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| InChI Key | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| Molecular Formula | (C3H4O2)n |
2,2,2-Trichloroethyl chloroformate, 97%
CAS: 17341-93-4 MDL Number: MFCD00000810 InChI Key: LJCZNYWLQZZIOS-UHFFFAOYSA-N Synonym: 2,2,2-trichloroethyl chloroformate,trichloroethyl chloroformate,2,2,2-trichloroethylchloroformate,carbonochloridic acid, 2,2,2-trichloroethyl ester,2,2,2-trichloroethoxycarbonyl chloride,chloroformic acid 2,2,2-trichloroethyl ester,formic acid, chloro-, 2,2,2-trichloroethyl ester,chloro 2,2,2-trichloroethoxy methanone,beta, beta, beta-trichloroethoxycarbonyl chloride,troc PubChem CID: 87063 IUPAC Name: 2,2,2-trichloroethyl carbonochloridate SMILES: C(C(Cl)(Cl)Cl)OC(=O)Cl
| PubChem CID | 87063 |
|---|---|
| CAS | 17341-93-4 |
| MDL Number | MFCD00000810 |
| SMILES | C(C(Cl)(Cl)Cl)OC(=O)Cl |
| Synonym | 2,2,2-trichloroethyl chloroformate,trichloroethyl chloroformate,2,2,2-trichloroethylchloroformate,carbonochloridic acid, 2,2,2-trichloroethyl ester,2,2,2-trichloroethoxycarbonyl chloride,chloroformic acid 2,2,2-trichloroethyl ester,formic acid, chloro-, 2,2,2-trichloroethyl ester,chloro 2,2,2-trichloroethoxy methanone,beta, beta, beta-trichloroethoxycarbonyl chloride,troc |
| IUPAC Name | 2,2,2-trichloroethyl carbonochloridate |
| InChI Key | LJCZNYWLQZZIOS-UHFFFAOYSA-N |
2,2,4-Trimethylpentane, Environmental Grade, 99.5+%
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.232 MDL Number: MFCD00008943 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane PubChem CID: 10907 ChEBI: CHEBI:62805 IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| PubChem CID | 10907 |
|---|---|
| CAS | 540-84-1 |
| Molecular Weight (g/mol) | 114.232 |
| ChEBI | CHEBI:62805 |
| MDL Number | MFCD00008943 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
Benzyl 2-bromoacetate, 96%
CAS: 5437-45-6 Molecular Formula: C9H9BrO2 Molecular Weight (g/mol): 229.08 MDL Number: MFCD00000190 InChI Key: JHVLLYQQQYIWKX-UHFFFAOYSA-N Synonym: benzyl bromoacetate,bromoacetic acid benzyl ester,acetic acid, bromo-, phenylmethyl ester,merbac 35,caswell no. 082a,acetic acid, bromo-, benzyl ester,unii-64u2rk18d3,phenylmethyl 2-bromoacetate,epa pesticide chemical code 008710,benzyl bromacetate PubChem CID: 62576 IUPAC Name: benzyl 2-bromoacetate SMILES: C1=CC=C(C=C1)COC(=O)CBr
| PubChem CID | 62576 |
|---|---|
| CAS | 5437-45-6 |
| Molecular Weight (g/mol) | 229.08 |
| MDL Number | MFCD00000190 |
| SMILES | C1=CC=C(C=C1)COC(=O)CBr |
| Synonym | benzyl bromoacetate,bromoacetic acid benzyl ester,acetic acid, bromo-, phenylmethyl ester,merbac 35,caswell no. 082a,acetic acid, bromo-, benzyl ester,unii-64u2rk18d3,phenylmethyl 2-bromoacetate,epa pesticide chemical code 008710,benzyl bromacetate |
| IUPAC Name | benzyl 2-bromoacetate |
| InChI Key | JHVLLYQQQYIWKX-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO2 |
Hydrazine acetate, 97%
CAS: 7335-65-1 Molecular Formula: C2H8N2O2 Molecular Weight (g/mol): 92.10 MDL Number: MFCD00013141 InChI Key: YFHNDHXQDJQEEE-UHFFFAOYSA-N Synonym: hydrazine acetate,hydrazinium acetate,hydrazine, monoacetate,hydrazine monoacetate,acetic acid; hydrazine,hydrazineacetate,hydrazine, acetate 1:1,acetic acid; diamine,hydrazine mono-acetate,acmc-209bph PubChem CID: 165591 IUPAC Name: acetic acid;hydrazine SMILES: NN.CC(O)=O
| PubChem CID | 165591 |
|---|---|
| CAS | 7335-65-1 |
| Molecular Weight (g/mol) | 92.10 |
| MDL Number | MFCD00013141 |
| SMILES | NN.CC(O)=O |
| Synonym | hydrazine acetate,hydrazinium acetate,hydrazine, monoacetate,hydrazine monoacetate,acetic acid; hydrazine,hydrazineacetate,hydrazine, acetate 1:1,acetic acid; diamine,hydrazine mono-acetate,acmc-209bph |
| IUPAC Name | acetic acid;hydrazine |
| InChI Key | YFHNDHXQDJQEEE-UHFFFAOYSA-N |
| Molecular Formula | C2H8N2O2 |
2,4-Thiazolidinedione, 99%
CAS: 2295-31-0 Molecular Formula: C3H3NO2S Molecular Weight (g/mol): 117.12 MDL Number: MFCD00005478 InChI Key: ZOBPZXTWZATXDG-UHFFFAOYSA-N Synonym: 2,4-thiazolidinedione,thiazolidinedione,thiazolidine-2,4-dione,2,4-dioxothiazolidine,2,4 3h,5h-thiazoledione,usaf ek-5496,thiazolidindione,unii-aa68lxk93c,2,4 thiazolidinedione,thiazolidinedione-2,4 PubChem CID: 5437 ChEBI: CHEBI:50992 IUPAC Name: 1,3-thiazolidine-2,4-dione SMILES: C1C(=O)NC(=O)S1
| PubChem CID | 5437 |
|---|---|
| CAS | 2295-31-0 |
| Molecular Weight (g/mol) | 117.12 |
| ChEBI | CHEBI:50992 |
| MDL Number | MFCD00005478 |
| SMILES | C1C(=O)NC(=O)S1 |
| Synonym | 2,4-thiazolidinedione,thiazolidinedione,thiazolidine-2,4-dione,2,4-dioxothiazolidine,2,4 3h,5h-thiazoledione,usaf ek-5496,thiazolidindione,unii-aa68lxk93c,2,4 thiazolidinedione,thiazolidinedione-2,4 |
| IUPAC Name | 1,3-thiazolidine-2,4-dione |
| InChI Key | ZOBPZXTWZATXDG-UHFFFAOYSA-N |
| Molecular Formula | C3H3NO2S |
Perfluoro(methyldecahydronaphthalene), tech. 85%, mixture of isomers, Thermo Scientific Chemicals
CAS: 51294-16-7 Molecular Formula: C11F20 Molecular Weight (g/mol): 512.09 MDL Number: MFCD00014326 InChI Key: LWRNQOBXRHWPGE-UHFFFAOYNA-N Synonym: perfluoromethyldecalin,perfluoro methyldecalin,flutec pp9,perfluoro 1-methyldecalin,perfluoro-1-methyldecalin,pp 9,perfluoro methyldecalin , tech.,naphthalene, 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluorodecahydro-8-trifluoromethyl,heptadecafluorodecahydro-1-trifluoromethyl naphthalene,1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-trifluoromethyl naphthalene PubChem CID: 39977 IUPAC Name: 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene SMILES: FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C12F
| PubChem CID | 39977 |
|---|---|
| CAS | 51294-16-7 |
| Molecular Weight (g/mol) | 512.09 |
| MDL Number | MFCD00014326 |
| SMILES | FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C12F |
| Synonym | perfluoromethyldecalin,perfluoro methyldecalin,flutec pp9,perfluoro 1-methyldecalin,perfluoro-1-methyldecalin,pp 9,perfluoro methyldecalin , tech.,naphthalene, 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluorodecahydro-8-trifluoromethyl,heptadecafluorodecahydro-1-trifluoromethyl naphthalene,1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-trifluoromethyl naphthalene |
| IUPAC Name | 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene |
| InChI Key | LWRNQOBXRHWPGE-UHFFFAOYNA-N |
| Molecular Formula | C11F20 |
Borane-tert-butylamine complex, 95%, powder
CAS: 7337-45-3 Molecular Formula: C4H14BN Molecular Weight (g/mol): 86.97 MDL Number: MFCD00075635 InChI Key: GKFJEDWZQZKYHV-UHFFFAOYSA-N Synonym: tert-butylamine borane,borane-tert-butylamine complex,borane tert-butylamine complex,borane-tert-butylaminecomplex,c4h14bn,borane t-butylamine,t-butylamine.borane,tert-butylamineborane,borane tert-butylamine,tert-butylamine-borane PubChem CID: 6364547 IUPAC Name: boron;2-methylpropan-2-amine SMILES: B.CC(C)(C)N
| PubChem CID | 6364547 |
|---|---|
| CAS | 7337-45-3 |
| Molecular Weight (g/mol) | 86.97 |
| MDL Number | MFCD00075635 |
| SMILES | B.CC(C)(C)N |
| Synonym | tert-butylamine borane,borane-tert-butylamine complex,borane tert-butylamine complex,borane-tert-butylaminecomplex,c4h14bn,borane t-butylamine,t-butylamine.borane,tert-butylamineborane,borane tert-butylamine,tert-butylamine-borane |
| IUPAC Name | boron;2-methylpropan-2-amine |
| InChI Key | GKFJEDWZQZKYHV-UHFFFAOYSA-N |
| Molecular Formula | C4H14BN |
Isosorbide mononitrate, 98+%
CAS: 16051-77-7 Molecular Formula: C6H9NO6 Molecular Weight (g/mol): 191.139 MDL Number: MFCD00143462 InChI Key: YWXYYJSYQOXTPL-SLPGGIOYSA-N Synonym: isosorbide mononitrate,isosorbide 5-mononitrate,monosorbitrate,imdur,elantan,monoket,mononit,corangin,ismn,isosorbide 5-nitrate PubChem CID: 27661 ChEBI: CHEBI:6062 IUPAC Name: [(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate SMILES: C1C(C2C(O1)C(CO2)O[N+](=O)[O-])O
| PubChem CID | 27661 |
|---|---|
| CAS | 16051-77-7 |
| Molecular Weight (g/mol) | 191.139 |
| ChEBI | CHEBI:6062 |
| MDL Number | MFCD00143462 |
| SMILES | C1C(C2C(O1)C(CO2)O[N+](=O)[O-])O |
| Synonym | isosorbide mononitrate,isosorbide 5-mononitrate,monosorbitrate,imdur,elantan,monoket,mononit,corangin,ismn,isosorbide 5-nitrate |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| InChI Key | YWXYYJSYQOXTPL-SLPGGIOYSA-N |
| Molecular Formula | C6H9NO6 |
n-Hexyllithium, 2.5M (33 wt.%) solution in hexane, AcroSeal™, Thermo Scientific Chemicals
CAS: 21369-64-2 Molecular Formula: C6H13Li Molecular Weight (g/mol): 92.11 MDL Number: MFCD00191446 InChI Key: CETVQRFGPOGIQJ-UHFFFAOYSA-N Synonym: n-hexyllithium,lithium, hexyl,hexyllithium,hexyl lithium,hexyl-lithium,lithium hexane,n-hexyllithiurn,n-hexyllitium,n-hexyl lithium,hexli PubChem CID: 2733163 IUPAC Name: lithium;hexane SMILES: [Li+].CCCCC[CH2-]
| PubChem CID | 2733163 |
|---|---|
| CAS | 21369-64-2 |
| Molecular Weight (g/mol) | 92.11 |
| MDL Number | MFCD00191446 |
| SMILES | [Li+].CCCCC[CH2-] |
| Synonym | n-hexyllithium,lithium, hexyl,hexyllithium,hexyl lithium,hexyl-lithium,lithium hexane,n-hexyllithiurn,n-hexyllitium,n-hexyl lithium,hexli |
| IUPAC Name | lithium;hexane |
| InChI Key | CETVQRFGPOGIQJ-UHFFFAOYSA-N |
| Molecular Formula | C6H13Li |
1-Propylphosphonic acid cyclic anhydride, 50+% soln. in ethyl acetate, Thermo Scientific Chemicals
CAS: 68957-94-8 Molecular Formula: C9H21O6P3 MDL Number: MFCD00006583 InChI Key: PAQZWJGSJMLPMG-UHFFFAOYSA-N PubChem CID: 111923
| PubChem CID | 111923 |
|---|---|
| CAS | 68957-94-8 |
| MDL Number | MFCD00006583 |
| InChI Key | PAQZWJGSJMLPMG-UHFFFAOYSA-N |
| Molecular Formula | C9H21O6P3 |
(-)-Gallocatechin
CAS: 3371-27-5 Molecular Formula: C15H14O7 Molecular Weight (g/mol): 306.27 MDL Number: MFCD01632616 InChI Key: XMOCLSLCDHWDHP-DOMZBBRYSA-N Synonym: --gallocatechin,2s,3r-2-3,4,5-trihydroxyphenyl chroman-3,5,7-triol,2s,3r-gallocatechin,ent-gallocatechin,2s,3r-flavan-3,3',4',5,5',7-hexol,2s,3r-flavan-3,5,7,3',4',5'-hexol,2s,3r-2-3,4,5-trihydroxyphenyl-3,4-dihydro-2h-chromene-3,5,7-triol,2s,3r---2-3,4,5-trihydroxyphenyl-3,4-dihydro-2h-chromene-3,5,7-triol,gallocatechingc,l-gallocatechin PubChem CID: 9882981 ChEBI: CHEBI:71225 IUPAC Name: (2S,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol SMILES: C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O
| PubChem CID | 9882981 |
|---|---|
| CAS | 3371-27-5 |
| Molecular Weight (g/mol) | 306.27 |
| ChEBI | CHEBI:71225 |
| MDL Number | MFCD01632616 |
| SMILES | C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)O |
| Synonym | --gallocatechin,2s,3r-2-3,4,5-trihydroxyphenyl chroman-3,5,7-triol,2s,3r-gallocatechin,ent-gallocatechin,2s,3r-flavan-3,3',4',5,5',7-hexol,2s,3r-flavan-3,5,7,3',4',5'-hexol,2s,3r-2-3,4,5-trihydroxyphenyl-3,4-dihydro-2h-chromene-3,5,7-triol,2s,3r---2-3,4,5-trihydroxyphenyl-3,4-dihydro-2h-chromene-3,5,7-triol,gallocatechingc,l-gallocatechin |
| IUPAC Name | (2S,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| InChI Key | XMOCLSLCDHWDHP-DOMZBBRYSA-N |
| Molecular Formula | C15H14O7 |
2,2'-Dinaphthyl ether, 98+%
CAS: 613-80-9 Molecular Formula: C20H14O Molecular Weight (g/mol): 270.33 MDL Number: MFCD00015447 InChI Key: DZRLNYVDCIYXPG-UHFFFAOYSA-N PubChem CID: 69183 IUPAC Name: 2-naphthalen-2-yloxynaphthalene SMILES: O(C1=CC=C2C=CC=CC2=C1)C1=CC=C2C=CC=CC2=C1
| PubChem CID | 69183 |
|---|---|
| CAS | 613-80-9 |
| Molecular Weight (g/mol) | 270.33 |
| MDL Number | MFCD00015447 |
| SMILES | O(C1=CC=C2C=CC=CC2=C1)C1=CC=C2C=CC=CC2=C1 |
| IUPAC Name | 2-naphthalen-2-yloxynaphthalene |
| InChI Key | DZRLNYVDCIYXPG-UHFFFAOYSA-N |
| Molecular Formula | C20H14O |
1-Tridecanol 98.0+%, TCI America™
CAS: 112-70-9 Molecular Formula: C13H28O Molecular Weight (g/mol): 200.366 MDL Number: MFCD00004756 InChI Key: XFRVVPUIAFSTFO-UHFFFAOYSA-N Synonym: 1-tridecanol,tridecanol,tridecyl alcohol,n-tridecan-1-ol,n-tridecanol,n-tridecyl alcohol,alcohols, c12-14,ccris 8591,dsstox_cid_1947,dsstox_rid_76420 PubChem CID: 8207 ChEBI: CHEBI:34123 IUPAC Name: tridecan-1-ol SMILES: CCCCCCCCCCCCCO
| PubChem CID | 8207 |
|---|---|
| CAS | 112-70-9 |
| Molecular Weight (g/mol) | 200.366 |
| ChEBI | CHEBI:34123 |
| MDL Number | MFCD00004756 |
| SMILES | CCCCCCCCCCCCCO |
| Synonym | 1-tridecanol,tridecanol,tridecyl alcohol,n-tridecan-1-ol,n-tridecanol,n-tridecyl alcohol,alcohols, c12-14,ccris 8591,dsstox_cid_1947,dsstox_rid_76420 |
| IUPAC Name | tridecan-1-ol |
| InChI Key | XFRVVPUIAFSTFO-UHFFFAOYSA-N |
| Molecular Formula | C13H28O |
Isovaleric acid, 99%
CAS: 503-74-2 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00002726 InChI Key: GWYFCOCPABKNJV-UHFFFAOYSA-N Synonym: isovaleric acid,isopentanoic acid,3-methylbutyric acid,delphinic acid,isopropylacetic acid,butanoic acid, 3-methyl,isovalerianic acid,isobutylformic acid,3-methylbutyrate,beta-methylbutyric acid PubChem CID: 10430 ChEBI: CHEBI:28484 IUPAC Name: 3-methylbutanoic acid SMILES: CC(C)CC(O)=O
| PubChem CID | 10430 |
|---|---|
| CAS | 503-74-2 |
| Molecular Weight (g/mol) | 102.13 |
| ChEBI | CHEBI:28484 |
| MDL Number | MFCD00002726 |
| SMILES | CC(C)CC(O)=O |
| Synonym | isovaleric acid,isopentanoic acid,3-methylbutyric acid,delphinic acid,isopropylacetic acid,butanoic acid, 3-methyl,isovalerianic acid,isobutylformic acid,3-methylbutyrate,beta-methylbutyric acid |
| IUPAC Name | 3-methylbutanoic acid |
| InChI Key | GWYFCOCPABKNJV-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |